C24H38F2N2O4 — CID 123666323
17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol (PubChem CID 123666323) has the molecular formula C24H38F2N2O4 and a molecular weight of 456.57 g/mol. Its IUPAC name is 17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol.
| Compound Name | 17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
|---|---|
| PubChem CID | 123666323 |
| Molecular Formula | C24H38F2N2O4 |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 17-[1-(2,2-difluoroethylamino)ethyl]-6-methoxyimino-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,14-triol |
| SMILES | CON=C1C=C2C(CCC3(C)C(C(C)NCC(F)F)CCC23O)C2(C)CC(O)C(O)CC12 |
| InChI | InChI=1S/C24H38F2N2O4/c1-13(27-12-21(25)26)14-6-8-24(31)16-9-18(28-32-4)17-10-19(29)20(30)11-22(17,2)15(16)5-7-23(14,24)3/h9,13-15,17,19-21,27,29-31H,5-8,10-12H2,1-4H3 |
| InChIKey | XMQGVPFGFDASBV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|