C48H68N8O5 — CID 123666434
N,N'-bis[4-[2-(4-furo[3,2-c]pyridin-4-ylpiperazin-1-yl)ethyl]cyclohexyl]-2-(3-methoxycyclopentyl)butanediamide (PubChem CID 123666434) has the molecular formula C48H68N8O5 and a molecular weight of 837.12 g/mol. Its IUPAC name is N,N'-bis[4-[2-(4-furo[3,2-c]pyridin-4-ylpiperazin-1-yl)ethyl]cyclohexyl]-2-(3-methoxycyclopentyl)butanediamide.
| Compound Name | N,N'-bis[4-[2-(4-furo[3,2-c]pyridin-4-ylpiperazin-1-yl)ethyl]cyclohexyl]-2-(3-methoxycyclopentyl)butanediamide |
|---|---|
| PubChem CID | 123666434 |
| Molecular Formula | C48H68N8O5 |
| Molecular Weight | 837.12 g/mol |
| Exact Mass | 836.53 |
| IUPAC Name | N,N'-bis[4-[2-(4-furo[3,2-c]pyridin-4-ylpiperazin-1-yl)ethyl]cyclohexyl]-2-(3-methoxycyclopentyl)butanediamide |
| SMILES | COC1CCC(C(CC(=O)NC2CCC(CCN3CCN(c4nccc5occc45)CC3)CC2)C(=O)NC2CCC(CCN3CCN(c4nccc5occc45)CC3)CC2)C1 |
| InChI | InChI=1S/C48H68N8O5/c1-59-39-11-6-36(32-39)42(48(58)52-38-9-4-35(5-10-38)15-21-54-24-28-56(29-25-54)47-41-17-31-61-44(41)13-19-50-47)33-45(57)51-37-7-2-34(3-8-37)14-20-53-22-26-55(27-23-53)46-40-16-30-60-43(40)12-18-49-46/h12-13,16-19,30-31,34-39,42H,2-11,14-15,20-29,32-33H2,1H3,(H,51,57)(H,52,58) |
| InChIKey | SNFVISHVPBWXFX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.12 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |