About N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide
N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide (PubChem CID 123666520) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide |
| PubChem CID | 123666520 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide |
| SMILES | C/N=C/Nc1ccn(C)c1C |
| InChI | InChI=1S/C8H13N3/c1-7-8(10-6-9-2)4-5-11(7)3/h4-6H,1-3H3,(H,9,10) |
| InChIKey | JAPACMNLGOHPJY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide?
The IUPAC name of N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide (CID 123666520) is N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide.
What is the SMILES notation for N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide?
The canonical SMILES for N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide is C/N=C/Nc1ccn(C)c1C.
What is the InChIKey of N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide?
The InChIKey is JAPACMNLGOHPJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-7-8(10-6-9-2)4-5-11(7)3/h4-6H,1-3H3,(H,9,10).
What are the key properties of N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide?
N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide has a molecular weight of 151.21 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-dimethylpyrrol-3-yl)-N'-methylmethanimidamide is sourced from PubChem (CID 123666520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).