C12H22O — CID 123666530
2-butyl-3,4,6-trimethyl-3,4-dihydro-2H-pyran (PubChem CID 123666530) has the molecular formula C12H22O and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-butyl-3,4,6-trimethyl-3,4-dihydro-2H-pyran.
| Compound Name | 2-butyl-3,4,6-trimethyl-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 123666530 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-butyl-3,4,6-trimethyl-3,4-dihydro-2H-pyran |
| SMILES | CCCCC1OC(C)=CC(C)C1C |
| InChI | InChI=1S/C12H22O/c1-5-6-7-12-11(4)9(2)8-10(3)13-12/h8-9,11-12H,5-7H2,1-4H3 |
| InChIKey | RNRLFLPWXHRLPH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |