C28H46N8O6 — CID 123666732
9-butan-2-yl-12-ethenyl-15-[2-(methylamino)propanoylamino]-8,11,14-trioxo-13-propyl-1,7,10,13,18,19-hexazabicyclo[15.2.1]icosa-17(20),18-diene-6-carboxylic acid (PubChem CID 123666732) has the molecular formula C28H46N8O6 and a molecular weight of 590.73 g/mol. Its IUPAC name is 9-butan-2-yl-12-ethenyl-15-[2-(methylamino)propanoylamino]-8,11,14-trioxo-13-propyl-1,7,10,13,18,19-hexazabicyclo[15.2.1]icosa-17(20),18-diene-6-carboxylic acid.
| Compound Name | 9-butan-2-yl-12-ethenyl-15-[2-(methylamino)propanoylamino]-8,11,14-trioxo-13-propyl-1,7,10,13,18,19-hexazabicyclo[15.2.1]icosa-17(20),18-diene-6-carboxylic acid |
|---|---|
| PubChem CID | 123666732 |
| Molecular Formula | C28H46N8O6 |
| Molecular Weight | 590.73 g/mol |
| Exact Mass | 590.35 |
| IUPAC Name | 9-butan-2-yl-12-ethenyl-15-[2-(methylamino)propanoylamino]-8,11,14-trioxo-13-propyl-1,7,10,13,18,19-hexazabicyclo[15.2.1]icosa-17(20),18-diene-6-carboxylic acid |
| SMILES | C=CC1C(=O)NC(C(C)CC)C(=O)NC(C(=O)O)CCCCn2cc(nn2)CC(NC(=O)C(C)NC)C(=O)N1CCC |
| InChI | InChI=1S/C28H46N8O6/c1-7-13-36-22(9-3)25(38)32-23(17(4)8-2)26(39)30-20(28(41)42)12-10-11-14-35-16-19(33-34-35)15-21(27(36)40)31-24(37)18(5)29-6/h9,16-18,20-23,29H,3,7-8,10-15H2,1-2,4-6H3,(H,30,39)(H,31,37)(H,32,38)(H,41,42) |
| InChIKey | LHKKFISCIDMQLE-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 187.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.73 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|