C10H7BrFNO — CID 123666784
1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene (PubChem CID 123666784) has the molecular formula C10H7BrFNO and a molecular weight of 256.07 g/mol. Its IUPAC name is 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene.
| Compound Name | 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 123666784 |
| Molecular Formula | C10H7BrFNO |
| Molecular Weight | 256.07 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene |
| SMILES | C=C/C=C(/N=O)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H7BrFNO/c1-2-4-9(13-14)7-5-3-6-8(11)10(7)12/h2-6H,1H2/b9-4+ |
| InChIKey | NAZAYKXXKBYYGF-RUDMXATFSA-N |
| XLogP | 3.88 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.07 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|