About 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene
1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene (PubChem CID 123666784) has the molecular formula C10H7BrFNO
and a molecular weight of 256.07 g/mol. Its IUPAC name is 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene.
Molecular Properties
| Compound Name | 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene |
| PubChem CID | 123666784 |
| Molecular Formula | C10H7BrFNO |
| Molecular Weight | 256.07 g/mol |
| Exact Mass | 254.97 |
| IUPAC Name | 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene |
| SMILES | C=C/C=C(/N=O)c1cccc(Br)c1F |
| InChI | InChI=1S/C10H7BrFNO/c1-2-4-9(13-14)7-5-3-6-8(11)10(7)12/h2-6H,1H2/b9-4+ |
| InChIKey | NAZAYKXXKBYYGF-RUDMXATFSA-N |
| XLogP | 3.88 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.07 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene?
The IUPAC name of 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene (CID 123666784) is 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene.
What is the SMILES notation for 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene?
The canonical SMILES for 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene is C=C/C=C(/N=O)c1cccc(Br)c1F.
What is the InChIKey of 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene?
The InChIKey is NAZAYKXXKBYYGF-RUDMXATFSA-N. The full InChI is InChI=1S/C10H7BrFNO/c1-2-4-9(13-14)7-5-3-6-8(11)10(7)12/h2-6H,1H2/b9-4+.
What are the key properties of 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene?
1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene has a molecular weight of 256.07 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-fluoro-3-[(1E)-1-nitrosobuta-1,3-dienyl]benzene is sourced from PubChem (CID 123666784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).