About 5-(disulfanyl)-1-methylpyrimidine-2,4-dione
5-(disulfanyl)-1-methylpyrimidine-2,4-dione (PubChem CID 123666794) has the molecular formula C5H6N2O2S2
and a molecular weight of 190.25 g/mol. Its IUPAC name is 5-(disulfanyl)-1-methylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(disulfanyl)-1-methylpyrimidine-2,4-dione |
| PubChem CID | 123666794 |
| Molecular Formula | C5H6N2O2S2 |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 189.99 |
| IUPAC Name | 5-(disulfanyl)-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(SS)c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H6N2O2S2/c1-7-2-3(11-10)4(8)6-5(7)9/h2,10H,1H3,(H,6,8,9) |
| InChIKey | VMGOTOLKQXKNOM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(disulfanyl)-1-methylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(disulfanyl)-1-methylpyrimidine-2,4-dione?
The IUPAC name of 5-(disulfanyl)-1-methylpyrimidine-2,4-dione (CID 123666794) is 5-(disulfanyl)-1-methylpyrimidine-2,4-dione.
What is the SMILES notation for 5-(disulfanyl)-1-methylpyrimidine-2,4-dione?
The canonical SMILES for 5-(disulfanyl)-1-methylpyrimidine-2,4-dione is Cn1cc(SS)c(=O)[nH]c1=O.
What is the InChIKey of 5-(disulfanyl)-1-methylpyrimidine-2,4-dione?
The InChIKey is VMGOTOLKQXKNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2S2/c1-7-2-3(11-10)4(8)6-5(7)9/h2,10H,1H3,(H,6,8,9).
What are the key properties of 5-(disulfanyl)-1-methylpyrimidine-2,4-dione?
5-(disulfanyl)-1-methylpyrimidine-2,4-dione has a molecular weight of 190.25 g/mol, XLogP of 0.01, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(disulfanyl)-1-methylpyrimidine-2,4-dione is sourced from PubChem (CID 123666794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).