C18H14F3N3O3 — CID 123667540
N-[5-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylpenta-2,4-dienamide (PubChem CID 123667540) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-[5-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylpenta-2,4-dienamide.
| Compound Name | N-[5-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 123667540 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-[5-(2,2-difluoro-6-methyl-1,3-benzodioxol-5-yl)pyrazin-2-yl]-3-fluoro-2-methylpenta-2,4-dienamide |
| SMILES | C=CC(F)=C(C)C(=O)Nc1cnc(-c2cc3c(cc2C)OC(F)(F)O3)cn1 |
| InChI | InChI=1S/C18H14F3N3O3/c1-4-12(19)10(3)17(25)24-16-8-22-13(7-23-16)11-6-15-14(5-9(11)2)26-18(20,21)27-15/h4-8H,1H2,2-3H3,(H,23,24,25) |
| InChIKey | PYJKPLINXACNCP-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|