C22H24N2O3 — CID 123667818
2-[[4-[4-(dimethylamino)phenyl]anilino]methyl]-6-ethyl-3-hydroxypyran-4-one (PubChem CID 123667818) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-[[4-[4-(dimethylamino)phenyl]anilino]methyl]-6-ethyl-3-hydroxypyran-4-one.
| Compound Name | 2-[[4-[4-(dimethylamino)phenyl]anilino]methyl]-6-ethyl-3-hydroxypyran-4-one |
|---|---|
| PubChem CID | 123667818 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[[4-[4-(dimethylamino)phenyl]anilino]methyl]-6-ethyl-3-hydroxypyran-4-one |
| SMILES | CCc1cc(=O)c(O)c(CNc2ccc(-c3ccc(N(C)C)cc3)cc2)o1 |
| InChI | InChI=1S/C22H24N2O3/c1-4-19-13-20(25)22(26)21(27-19)14-23-17-9-5-15(6-10-17)16-7-11-18(12-8-16)24(2)3/h5-13,23,26H,4,14H2,1-3H3 |
| InChIKey | LHDHUUNGLUFGLA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |