C28H30ClN9O3 — CID 123667970
methyl N-[(10R,14S)-14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-10-methyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate (PubChem CID 123667970) has the molecular formula C28H30ClN9O3 and a molecular weight of 576.06 g/mol. Its IUPAC name is methyl N-[(10R,14S)-14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-10-methyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate.
| Compound Name | methyl N-[(10R,14S)-14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-10-methyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
|---|---|
| PubChem CID | 123667970 |
| Molecular Formula | C28H30ClN9O3 |
| Molecular Weight | 576.06 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | methyl N-[(10R,14S)-14-[3-[5-chloro-2-(tetrazol-1-yl)phenyl]prop-2-enoylamino]-10-methyl-8,16,18-triazatricyclo[13.2.1.02,7]octadeca-1(17),2(7),3,5,15-pentaen-5-yl]carbamate |
| SMILES | COC(=O)Nc1ccc2c(c1)NC[C@H](C)CCC[C@H](NC(=O)C=Cc1cc(Cl)ccc1-n1cnnn1)c1ncc-2[nH]1 |
| InChI | InChI=1S/C28H30ClN9O3/c1-17-4-3-5-22(34-26(39)11-6-18-12-19(29)7-10-25(18)38-16-32-36-37-38)27-31-15-24(35-27)21-9-8-20(33-28(40)41-2)13-23(21)30-14-17/h6-13,15-17,22,30H,3-5,14H2,1-2H3,(H,31,35)(H,33,40)(H,34,39)/t17-,22+/m1/s1 |
| InChIKey | HAXPUEDRRFVUCK-VGSWGCGISA-N |
| XLogP | 4.99 |
| TPSA | 151.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.06 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|