N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride

C5H9ClN2 — CID 123668040

IUPACN'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride
SMILESC/C=C\N/C(Cl)=N/C
InChIInChI=1S/C5H9ClN2/c1-3-4-8-5(6)7-2/h3-4H,1-2H3,(H,7,8)/b4-3-
InChIKeyDWIMLIVQZQKQTF-ARJAWSKDSA-N
MW132.59 g/mol
LogP1.33
Rot. Bonds1

About N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride

N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride (PubChem CID 123668040) has the molecular formula C5H9ClN2 and a molecular weight of 132.59 g/mol. Its IUPAC name is N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride.

Molecular Properties

Compound NameN'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride
PubChem CID123668040
Molecular FormulaC5H9ClN2
Molecular Weight132.59 g/mol
Exact Mass132.05
IUPAC NameN'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride
SMILESC/C=C\N/C(Cl)=N/C
InChIInChI=1S/C5H9ClN2/c1-3-4-8-5(6)7-2/h3-4H,1-2H3,(H,7,8)/b4-3-
InChIKeyDWIMLIVQZQKQTF-ARJAWSKDSA-N
XLogP1.33
TPSA24.39 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500132.59
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}

Analyze N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride?
The IUPAC name of N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride (CID 123668040) is N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride.
What is the SMILES notation for N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride?
The canonical SMILES for N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride is C/C=C\N/C(Cl)=N/C.
What is the InChIKey of N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride?
The InChIKey is DWIMLIVQZQKQTF-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H9ClN2/c1-3-4-8-5(6)7-2/h3-4H,1-2H3,(H,7,8)/b4-3-.
What are the key properties of N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride?
N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride has a molecular weight of 132.59 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-N-[(Z)-prop-1-enyl]carbamimidoyl chloride is sourced from PubChem (CID 123668040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).