C24H30N2O2 — CID 123668583
1-(4-tert-butylphenyl)-3-[(4-hexa-2,4-dien-2-yloxyphenyl)methyl]urea (PubChem CID 123668583) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[(4-hexa-2,4-dien-2-yloxyphenyl)methyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[(4-hexa-2,4-dien-2-yloxyphenyl)methyl]urea |
|---|---|
| PubChem CID | 123668583 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[(4-hexa-2,4-dien-2-yloxyphenyl)methyl]urea |
| SMILES | CC=CC=C(C)Oc1ccc(CNC(=O)Nc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O2/c1-6-7-8-18(2)28-22-15-9-19(10-16-22)17-25-23(27)26-21-13-11-20(12-14-21)24(3,4)5/h6-16H,17H2,1-5H3,(H2,25,26,27) |
| InChIKey | SENQHTSNSBWNQB-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|