C10H11F5O3S — CID 123669050
dihydroxy-(2-methylpropyl)-oxo-(2,3,4,5,6-pentafluorophenyl)-λ6-sulfane (PubChem CID 123669050) has the molecular formula C10H11F5O3S and a molecular weight of 306.25 g/mol. Its IUPAC name is dihydroxy-(2-methylpropyl)-oxo-(2,3,4,5,6-pentafluorophenyl)-λ6-sulfane.
| Compound Name | dihydroxy-(2-methylpropyl)-oxo-(2,3,4,5,6-pentafluorophenyl)-λ6-sulfane |
|---|---|
| PubChem CID | 123669050 |
| Molecular Formula | C10H11F5O3S |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | dihydroxy-(2-methylpropyl)-oxo-(2,3,4,5,6-pentafluorophenyl)-λ6-sulfane |
| SMILES | CC(C)CS(=O)(O)(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H11F5O3S/c1-4(2)3-19(16,17,18)10-8(14)6(12)5(11)7(13)9(10)15/h4H,3H2,1-2H3,(H2,16,17,18) |
| InChIKey | BGARYMZWUGKNKZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|