C28H48O7 — CID 123669176
[2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 5,9,13,17-tetramethyloctadec-4-enoate (PubChem CID 123669176) has the molecular formula C28H48O7 and a molecular weight of 496.69 g/mol. Its IUPAC name is [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 5,9,13,17-tetramethyloctadec-4-enoate.
| Compound Name | [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 5,9,13,17-tetramethyloctadec-4-enoate |
|---|---|
| PubChem CID | 123669176 |
| Molecular Formula | C28H48O7 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] 5,9,13,17-tetramethyloctadec-4-enoate |
| SMILES | CC(=CCCC(=O)OCC(O)C1OC(=O)C(O)C1=O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C28H48O7/c1-19(2)10-6-11-20(3)12-7-13-21(4)14-8-15-22(5)16-9-17-24(30)34-18-23(29)27-25(31)26(32)28(33)35-27/h16,19-21,23,26-27,29,32H,6-15,17-18H2,1-5H3 |
| InChIKey | CPXKWBKXOJDJKM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|