About (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium
(10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium (PubChem CID 123669456) has the molecular formula C21H42N+
and a molecular weight of 308.57 g/mol. Its IUPAC name is (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium.
Molecular Properties
| Compound Name | (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium |
| PubChem CID | 123669456 |
| Molecular Formula | C21H42N+ |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.33 |
| IUPAC Name | (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CCCCC(C)(C)CCC=C(C)CC1CCC1 |
| InChI | InChI=1S/C21H42N/c1-7-22(5,6)17-9-8-15-21(3,4)16-11-12-19(2)18-20-13-10-14-20/h12,20H,7-11,13-18H2,1-6H3/q+1 |
| InChIKey | HHDFLEXVHNFYJJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium?
The IUPAC name of (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium (CID 123669456) is (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium.
What is the SMILES notation for (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium?
The canonical SMILES for (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium is CC[N+](C)(C)CCCCC(C)(C)CCC=C(C)CC1CCC1.
What is the InChIKey of (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium?
The InChIKey is HHDFLEXVHNFYJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H42N/c1-7-22(5,6)17-9-8-15-21(3,4)16-11-12-19(2)18-20-13-10-14-20/h12,20H,7-11,13-18H2,1-6H3/q+1.
What are the key properties of (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium?
(10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium has a molecular weight of 308.57 g/mol, XLogP of 6.20, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (10-cyclobutyl-5,5,9-trimethyldec-8-enyl)-ethyl-dimethylazanium is sourced from PubChem (CID 123669456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).