C20H18ClFN4O2S — CID 123669859
N-[1-[(E)-3-(4-chlorophenyl)-1-isocyanopent-1-en-3-yl]-6-fluoroindazol-4-yl]methanesulfonamide (PubChem CID 123669859) has the molecular formula C20H18ClFN4O2S and a molecular weight of 432.91 g/mol. Its IUPAC name is N-[1-[(E)-3-(4-chlorophenyl)-1-isocyanopent-1-en-3-yl]-6-fluoroindazol-4-yl]methanesulfonamide.
| Compound Name | N-[1-[(E)-3-(4-chlorophenyl)-1-isocyanopent-1-en-3-yl]-6-fluoroindazol-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 123669859 |
| Molecular Formula | C20H18ClFN4O2S |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | N-[1-[(E)-3-(4-chlorophenyl)-1-isocyanopent-1-en-3-yl]-6-fluoroindazol-4-yl]methanesulfonamide |
| SMILES | [C-]#[N+]/C=C/C(CC)(c1ccc(Cl)cc1)n1ncc2c(NS(C)(=O)=O)cc(F)cc21 |
| InChI | InChI=1S/C20H18ClFN4O2S/c1-4-20(9-10-23-2,14-5-7-15(21)8-6-14)26-19-12-16(22)11-18(17(19)13-24-26)25-29(3,27)28/h5-13,25H,4H2,1,3H3/b10-9+ |
| InChIKey | ZIXLZWARJKELRP-MDZDMXLPSA-N |
| XLogP | 4.79 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|