C14H30N2O — CID 123670940
1-(4-methoxy-2,2,4-trimethylpentyl)-1,4-diazepane (PubChem CID 123670940) has the molecular formula C14H30N2O and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-(4-methoxy-2,2,4-trimethylpentyl)-1,4-diazepane.
| Compound Name | 1-(4-methoxy-2,2,4-trimethylpentyl)-1,4-diazepane |
|---|---|
| PubChem CID | 123670940 |
| Molecular Formula | C14H30N2O |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.24 |
| IUPAC Name | 1-(4-methoxy-2,2,4-trimethylpentyl)-1,4-diazepane |
| SMILES | COC(C)(C)CC(C)(C)CN1CCCNCC1 |
| InChI | InChI=1S/C14H30N2O/c1-13(2,11-14(3,4)17-5)12-16-9-6-7-15-8-10-16/h15H,6-12H2,1-5H3 |
| InChIKey | AFVKRCJGJHCDNM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |