About N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide
N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide (PubChem CID 123671236) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide.
Molecular Properties
| Compound Name | N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide |
| PubChem CID | 123671236 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide |
| SMILES | C=CC=C(C)N(C)C(=O)C(C)C |
| InChI | InChI=1S/C10H17NO/c1-6-7-9(4)11(5)10(12)8(2)3/h6-8H,1H2,2-5H3 |
| InChIKey | TYBJEDOWLZMYPZ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide?
The IUPAC name of N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide (CID 123671236) is N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide.
What is the SMILES notation for N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide?
The canonical SMILES for N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide is C=CC=C(C)N(C)C(=O)C(C)C.
What is the InChIKey of N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide?
The InChIKey is TYBJEDOWLZMYPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-6-7-9(4)11(5)10(12)8(2)3/h6-8H,1H2,2-5H3.
What are the key properties of N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide?
N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide has a molecular weight of 167.25 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-N-penta-2,4-dien-2-ylpropanamide is sourced from PubChem (CID 123671236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).