C21H23N3O — CID 123671312
2-(5-amino-2-ethyl-4,6,7,8-tetrahydroquinazolin-4-yl)-9H-benzo[7]annulen-1-ol (PubChem CID 123671312) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 2-(5-amino-2-ethyl-4,6,7,8-tetrahydroquinazolin-4-yl)-9H-benzo[7]annulen-1-ol.
| Compound Name | 2-(5-amino-2-ethyl-4,6,7,8-tetrahydroquinazolin-4-yl)-9H-benzo[7]annulen-1-ol |
|---|---|
| PubChem CID | 123671312 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 2-(5-amino-2-ethyl-4,6,7,8-tetrahydroquinazolin-4-yl)-9H-benzo[7]annulen-1-ol |
| SMILES | CCC1=NC(c2ccc3c(c2O)CC=CC=C3)C2=C(N)CCCC2=N1 |
| InChI | InChI=1S/C21H23N3O/c1-2-18-23-17-10-6-9-16(22)19(17)20(24-18)15-12-11-13-7-4-3-5-8-14(13)21(15)25/h3-5,7,11-12,20,25H,2,6,8-10,22H2,1H3 |
| InChIKey | AZZKZWRTTOOJQS-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|