C21H36O6 — CID 123671514
6-(hydroxymethyl)-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)oxane-2,3,5-triol (PubChem CID 123671514) has the molecular formula C21H36O6 and a molecular weight of 384.51 g/mol. Its IUPAC name is 6-(hydroxymethyl)-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)oxane-2,3,5-triol.
| Compound Name | 6-(hydroxymethyl)-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)oxane-2,3,5-triol |
|---|---|
| PubChem CID | 123671514 |
| Molecular Formula | C21H36O6 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 6-(hydroxymethyl)-4-(3,7,11-trimethyldodeca-2,6,10-trienoxy)oxane-2,3,5-triol |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCOC1C(O)C(O)OC(CO)C1O |
| InChI | InChI=1S/C21H36O6/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-26-20-18(23)17(13-22)27-21(25)19(20)24/h7,9,11,17-25H,5-6,8,10,12-13H2,1-4H3 |
| InChIKey | BUNSBTHDJOPSCE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|