C15H23NO2 — CID 123671654
N,N-diethyl-5-methyl-3-prop-2-enoxyhepta-2,4,6-trienamide (PubChem CID 123671654) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N,N-diethyl-5-methyl-3-prop-2-enoxyhepta-2,4,6-trienamide.
| Compound Name | N,N-diethyl-5-methyl-3-prop-2-enoxyhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 123671654 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N,N-diethyl-5-methyl-3-prop-2-enoxyhepta-2,4,6-trienamide |
| SMILES | C=CCOC(C=C(C)C=C)=CC(=O)N(CC)CC |
| InChI | InChI=1S/C15H23NO2/c1-6-10-18-14(11-13(5)7-2)12-15(17)16(8-3)9-4/h6-7,11-12H,1-2,8-10H2,3-5H3 |
| InChIKey | UYNAUFUZQBOGNU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|