About N-ethenyl-N-methylpenta-2,4-dien-2-amine
N-ethenyl-N-methylpenta-2,4-dien-2-amine (PubChem CID 123672208) has the molecular formula C8H13N
and a molecular weight of 123.20 g/mol. Its IUPAC name is N-ethenyl-N-methylpenta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | N-ethenyl-N-methylpenta-2,4-dien-2-amine |
| PubChem CID | 123672208 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | N-ethenyl-N-methylpenta-2,4-dien-2-amine |
| SMILES | C=CC=C(C)N(C)C=C |
| InChI | InChI=1S/C8H13N/c1-5-7-8(3)9(4)6-2/h5-7H,1-2H2,3-4H3 |
| InChIKey | TUAUZQQIQZUHTR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N-methylpenta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N-methylpenta-2,4-dien-2-amine?
The IUPAC name of N-ethenyl-N-methylpenta-2,4-dien-2-amine (CID 123672208) is N-ethenyl-N-methylpenta-2,4-dien-2-amine.
What is the SMILES notation for N-ethenyl-N-methylpenta-2,4-dien-2-amine?
The canonical SMILES for N-ethenyl-N-methylpenta-2,4-dien-2-amine is C=CC=C(C)N(C)C=C.
What is the InChIKey of N-ethenyl-N-methylpenta-2,4-dien-2-amine?
The InChIKey is TUAUZQQIQZUHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N/c1-5-7-8(3)9(4)6-2/h5-7H,1-2H2,3-4H3.
What are the key properties of N-ethenyl-N-methylpenta-2,4-dien-2-amine?
N-ethenyl-N-methylpenta-2,4-dien-2-amine has a molecular weight of 123.20 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N-methylpenta-2,4-dien-2-amine is sourced from PubChem (CID 123672208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).