C26H34FN3O10P+ — CID 123672232
(3R,4R,10S)-3-fluoro-4-hydroxy-3,10-dimethyl-8-oxo-8-phenoxy-7,12,25-trioxa-9,20-diaza-1-azonia-8λ5-phosphatricyclo[18.3.1.12,5]pentacos-1(23)-ene-11,19,21,24-tetrone (PubChem CID 123672232) has the molecular formula C26H34FN3O10P+ and a molecular weight of 598.54 g/mol. Its IUPAC name is (3R,4R,10S)-3-fluoro-4-hydroxy-3,10-dimethyl-8-oxo-8-phenoxy-7,12,25-trioxa-9,20-diaza-1-azonia-8λ5-phosphatricyclo[18.3.1.12,5]pentacos-1(23)-ene-11,19,21,24-tetrone.
| Compound Name | (3R,4R,10S)-3-fluoro-4-hydroxy-3,10-dimethyl-8-oxo-8-phenoxy-7,12,25-trioxa-9,20-diaza-1-azonia-8λ5-phosphatricyclo[18.3.1.12,5]pentacos-1(23)-ene-11,19,21,24-tetrone |
|---|---|
| PubChem CID | 123672232 |
| Molecular Formula | C26H34FN3O10P+ |
| Molecular Weight | 598.54 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | (3R,4R,10S)-3-fluoro-4-hydroxy-3,10-dimethyl-8-oxo-8-phenoxy-7,12,25-trioxa-9,20-diaza-1-azonia-8λ5-phosphatricyclo[18.3.1.12,5]pentacos-1(23)-ene-11,19,21,24-tetrone |
| SMILES | C[C@@H]1NP(=O)(Oc2ccccc2)OCC2OC([N+]3=CCC(=O)N(C(=O)CCCCCCOC1=O)C3=O)[C@](C)(F)[C@@H]2O |
| InChI | InChI=1S/C26H34FN3O10P/c1-17-23(34)37-15-9-4-3-8-12-20(31)30-21(32)13-14-29(25(30)35)24-26(2,27)22(33)19(39-24)16-38-41(36,28-17)40-18-10-6-5-7-11-18/h5-7,10-11,14,17,19,22,24,33H,3-4,8-9,12-13,15-16H2,1-2H3,(H,28,36)/q+1/t17-,19?,22+,24?,26+,41?/m0/s1 |
| InChIKey | NBZHQGNTAWXVPD-SDJNZJTNSA-N |
| XLogP | 2.45 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.54 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|