C32H32F3N7O2S — CID 123672402
N-[[3-[2-amino-5-[2-[[2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]amino]pyrimidin-4-yl]-1,3-thiazol-4-yl]phenyl]methyl]cyclohexanecarboxamide (PubChem CID 123672402) has the molecular formula C32H32F3N7O2S and a molecular weight of 635.72 g/mol. Its IUPAC name is N-[[3-[2-amino-5-[2-[[2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]amino]pyrimidin-4-yl]-1,3-thiazol-4-yl]phenyl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[[3-[2-amino-5-[2-[[2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]amino]pyrimidin-4-yl]-1,3-thiazol-4-yl]phenyl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 123672402 |
| Molecular Formula | C32H32F3N7O2S |
| Molecular Weight | 635.72 g/mol |
| Exact Mass | 635.23 |
| IUPAC Name | N-[[3-[2-amino-5-[2-[[2-(2,2,2-trifluoroacetyl)-3,4-dihydro-1H-isoquinolin-7-yl]amino]pyrimidin-4-yl]-1,3-thiazol-4-yl]phenyl]methyl]cyclohexanecarboxamide |
| SMILES | Nc1nc(-c2cccc(CNC(=O)C3CCCCC3)c2)c(-c2ccnc(Nc3ccc4c(c3)CN(C(=O)C(F)(F)F)CC4)n2)s1 |
| InChI | InChI=1S/C32H32F3N7O2S/c33-32(34,35)29(44)42-14-12-20-9-10-24(16-23(20)18-42)39-31-37-13-11-25(40-31)27-26(41-30(36)45-27)22-8-4-5-19(15-22)17-38-28(43)21-6-2-1-3-7-21/h4-5,8-11,13,15-16,21H,1-3,6-7,12,14,17-18H2,(H2,36,41)(H,38,43)(H,37,39,40) |
| InChIKey | WFGUQSXJWPDNKT-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.72 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |