C51H88Si7 — CID 123672783
tris[4,6-dimethyl-2,3-bis(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123672783) has the molecular formula C51H88Si7 and a molecular weight of 897.87 g/mol. Its IUPAC name is tris[4,6-dimethyl-2,3-bis(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris[4,6-dimethyl-2,3-bis(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123672783 |
| Molecular Formula | C51H88Si7 |
| Molecular Weight | 897.87 g/mol |
| Exact Mass | 896.53 |
| IUPAC Name | tris[4,6-dimethyl-2,3-bis(trimethylsilyl)phenyl]-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2c(C)cc(C)c([Si](C)(C)C)c2[Si](C)(C)C)(c2c(C)cc(C)c([Si](C)(C)C)c2[Si](C)(C)C)c2c(C)cc(C)c([Si](C)(C)C)c2[Si](C)(C)C)=C1C |
| InChI | InChI=1S/C51H88Si7/c1-32-29-35(4)45(49(55(20,21)22)42(32)52(11,12)13)58(48-40(9)38(7)39(8)41(48)10,46-36(5)30-33(2)43(53(14,15)16)50(46)56(23,24)25)47-37(6)31-34(3)44(54(17,18)19)51(47)57(26,27)28/h29-31,40H,1-28H3 |
| InChIKey | YUUDXCKOXYKTRZ-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.87 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|