About (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine
(E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine (PubChem CID 123673042) has the molecular formula C21H32FN
and a molecular weight of 317.49 g/mol. Its IUPAC name is (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine.
Molecular Properties
| Compound Name | (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine |
| PubChem CID | 123673042 |
| Molecular Formula | C21H32FN |
| Molecular Weight | 317.49 g/mol |
| Exact Mass | 317.25 |
| IUPAC Name | (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine |
| SMILES | C/N=C(/C=C(\C(C)C)C(CC(C)C)C(C)C)c1ccccc1F |
| InChI | InChI=1S/C21H32FN/c1-14(2)12-18(15(3)4)19(16(5)6)13-21(23-7)17-10-8-9-11-20(17)22/h8-11,13-16,18H,12H2,1-7H3/b19-13+,23-21- |
| InChIKey | BMFSDMXTZQWAAD-DNLCFCFBSA-N |
| XLogP | 6.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 317.49 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine?
The IUPAC name of (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine (CID 123673042) is (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine.
What is the SMILES notation for (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine?
The canonical SMILES for (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine is C/N=C(/C=C(\C(C)C)C(CC(C)C)C(C)C)c1ccccc1F.
What is the InChIKey of (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine?
The InChIKey is BMFSDMXTZQWAAD-DNLCFCFBSA-N. The full InChI is InChI=1S/C21H32FN/c1-14(2)12-18(15(3)4)19(16(5)6)13-21(23-7)17-10-8-9-11-20(17)22/h8-11,13-16,18H,12H2,1-7H3/b19-13+,23-21-.
What are the key properties of (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine?
(E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine has a molecular weight of 317.49 g/mol, XLogP of 6.15, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(2-fluorophenyl)-N,6-dimethyl-3,4-di(propan-2-yl)hept-2-en-1-imine is sourced from PubChem (CID 123673042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).