C31H54FN — CID 123673126
N-[(2-ethenyl-4-ethyl-5-fluoro-4-pentylcyclohept-2-en-1-yl)methyl]-2,3,8-trimethyl-7-propylcyclooct-2-en-1-amine (PubChem CID 123673126) has the molecular formula C31H54FN and a molecular weight of 459.78 g/mol. Its IUPAC name is N-[(2-ethenyl-4-ethyl-5-fluoro-4-pentylcyclohept-2-en-1-yl)methyl]-2,3,8-trimethyl-7-propylcyclooct-2-en-1-amine.
| Compound Name | N-[(2-ethenyl-4-ethyl-5-fluoro-4-pentylcyclohept-2-en-1-yl)methyl]-2,3,8-trimethyl-7-propylcyclooct-2-en-1-amine |
|---|---|
| PubChem CID | 123673126 |
| Molecular Formula | C31H54FN |
| Molecular Weight | 459.78 g/mol |
| Exact Mass | 459.42 |
| IUPAC Name | N-[(2-ethenyl-4-ethyl-5-fluoro-4-pentylcyclohept-2-en-1-yl)methyl]-2,3,8-trimethyl-7-propylcyclooct-2-en-1-amine |
| SMILES | C=CC1=CC(CC)(CCCCC)C(F)CCC1CNC1C(C)=C(C)CCCC(CCC)C1C |
| InChI | InChI=1S/C31H54FN/c1-8-12-13-20-31(11-4)21-26(10-3)28(18-19-29(31)32)22-33-30-24(6)23(5)16-14-17-27(15-9-2)25(30)7/h10,21,25,27-30,33H,3,8-9,11-20,22H2,1-2,4-7H3 |
| InChIKey | WVFGEVIYCMCBQQ-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.78 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|