About (Z)-hex-4-ene-1,3-diimine
(Z)-hex-4-ene-1,3-diimine (PubChem CID 123673268) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is (Z)-hex-4-ene-1,3-diimine.
Molecular Properties
| Compound Name | (Z)-hex-4-ene-1,3-diimine |
| PubChem CID | 123673268 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (Z)-hex-4-ene-1,3-diimine |
| SMILES | [H]/N=C(\C=C/C)C/C=N/[H] |
| InChI | InChI=1S/C6H10N2/c1-2-3-6(8)4-5-7/h2-3,5,7-8H,4H2,1H3/b3-2-,7-5+,8-6+ |
| InChIKey | ICMLPZQVEMFZOE-COTIHKRRSA-N |
| XLogP | 1.62 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-hex-4-ene-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-hex-4-ene-1,3-diimine?
The IUPAC name of (Z)-hex-4-ene-1,3-diimine (CID 123673268) is (Z)-hex-4-ene-1,3-diimine.
What is the SMILES notation for (Z)-hex-4-ene-1,3-diimine?
The canonical SMILES for (Z)-hex-4-ene-1,3-diimine is [H]/N=C(\C=C/C)C/C=N/[H].
What is the InChIKey of (Z)-hex-4-ene-1,3-diimine?
The InChIKey is ICMLPZQVEMFZOE-COTIHKRRSA-N. The full InChI is InChI=1S/C6H10N2/c1-2-3-6(8)4-5-7/h2-3,5,7-8H,4H2,1H3/b3-2-,7-5+,8-6+.
What are the key properties of (Z)-hex-4-ene-1,3-diimine?
(Z)-hex-4-ene-1,3-diimine has a molecular weight of 110.16 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-hex-4-ene-1,3-diimine is sourced from PubChem (CID 123673268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).