C24H28N2O7 — CID 1236741
(5S)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 1236741) has the molecular formula C24H28N2O7 and a molecular weight of 456.50 g/mol. Its IUPAC name is (5S)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 1236741 |
| Molecular Formula | C24H28N2O7 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (5S)-4-[(3,4-dimethoxyphenyl)-hydroxymethylidene]-5-(furan-2-yl)-1-(3-morpholin-4-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C(O)=C2C(=O)C(=O)N(CCCN3CCOCC3)[C@@H]2c2ccco2)cc1OC |
| InChI | InChI=1S/C24H28N2O7/c1-30-17-7-6-16(15-19(17)31-2)22(27)20-21(18-5-3-12-33-18)26(24(29)23(20)28)9-4-8-25-10-13-32-14-11-25/h3,5-7,12,15,21,27H,4,8-11,13-14H2,1-2H3/t21-/m1/s1 |
| InChIKey | SNKZXFXJFFZFLG-OAQYLSRUSA-N |
| XLogP | 2.44 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|