C15H30N4O4 — CID 123674154
N-[6-(diaminomethylamino)-4-(dihydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide (PubChem CID 123674154) has the molecular formula C15H30N4O4 and a molecular weight of 330.43 g/mol. Its IUPAC name is N-[6-(diaminomethylamino)-4-(dihydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[6-(diaminomethylamino)-4-(dihydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 123674154 |
| Molecular Formula | C15H30N4O4 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N-[6-(diaminomethylamino)-4-(dihydroxymethyl)-2-pentan-3-yloxycyclohex-3-en-1-yl]acetamide |
| SMILES | CCC(CC)OC1C=C(C(O)O)CC(NC(N)N)C1NC(C)=O |
| InChI | InChI=1S/C15H30N4O4/c1-4-10(5-2)23-12-7-9(14(21)22)6-11(19-15(16)17)13(12)18-8(3)20/h7,10-15,19,21-22H,4-6,16-17H2,1-3H3,(H,18,20) |
| InChIKey | ICVIOXOTTPCHPX-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 142.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|