About CID 123674269
CID 123674269 (PubChem CID 123674269) has the molecular formula C66H71B3N9O8
and a molecular weight of 1150.78 g/mol.
Molecular Properties
| Compound Name | CID 123674269 |
| PubChem CID | 123674269 |
| Molecular Formula | C66H71B3N9O8 |
| Molecular Weight | 1150.78 g/mol |
| Exact Mass | 1150.57 |
| IUPAC Name | — |
| SMILES | NCc1cccc(C2CCN(C(=O)c3cc([B]O)c4ccc(-c5cc(B(O)O)c6cncc(C(=O)N7CCC(c8cc(CN)cc(-c9ccc(C(=O)N%10CCC(c%11cccc(CN)c%11)CC%10)c%10c9CC(B(O)O)NC%10)c8)CC7)c6c5)cc4n3)CC2)c1 |
| InChI | InChI=1S/C66H71B3N9O8/c70-33-39-3-1-5-45(23-39)42-11-17-76(18-12-42)64(79)52-10-9-51(55-31-63(69(85)86)74-38-56(52)55)50-26-41(35-72)25-48(27-50)44-15-19-77(20-16-44)65(80)58-37-73-36-57-54(58)28-49(29-60(57)68(83)84)47-7-8-53-59(67-82)32-62(75-61(53)30-47)66(81)78-21-13-43(14-22-78)46-6-2-4-40(24-46)34-71/h1-10,23-30,32,36-37,42-44,63,74,82-86H,11-22,31,33-35,38,70-72H2 |
| InChIKey | PSIIYJWYGGLQHU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 277.95 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 86 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1150.78 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 14 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 123674269 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 123674269?
The IUPAC name of CID 123674269 (CID 123674269) is not available.
What is the SMILES notation for CID 123674269?
The canonical SMILES for CID 123674269 is NCc1cccc(C2CCN(C(=O)c3cc([B]O)c4ccc(-c5cc(B(O)O)c6cncc(C(=O)N7CCC(c8cc(CN)cc(-c9ccc(C(=O)N%10CCC(c%11cccc(CN)c%11)CC%10)c%10c9CC(B(O)O)NC%10)c8)CC7)c6c5)cc4n3)CC2)c1.
What is the InChIKey of CID 123674269?
The InChIKey is PSIIYJWYGGLQHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C66H71B3N9O8/c70-33-39-3-1-5-45(23-39)42-11-17-76(18-12-42)64(79)52-10-9-51(55-31-63(69(85)86)74-38-56(52)55)50-26-41(35-72)25-48(27-50)44-15-19-77(20-16-44)65(80)58-37-73-36-57-54(58)28-49(29-60(57)68(83)84)47-7-8-53-59(67-82)32-62(75-61(53)30-47)66(81)78-21-13-43(14-22-78)46-6-2-4-40(24-46)34-71/h1-10,23-30,32,36-37,42-44,63,74,82-86H,11-22,31,33-35,38,70-72H2.
What are the key properties of CID 123674269?
CID 123674269 has a molecular weight of 1150.78 g/mol, XLogP of 4.50, 14 rotatable bonds, 9 hydrogen bond donors, and 14 hydrogen bond acceptors.
Where does this data come from?
All data for CID 123674269 is sourced from PubChem (CID 123674269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).