C22H22N8O — CID 123674276
15-(2-phenylimidazol-1-yl)-7-propan-2-yl-9-oxa-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene (PubChem CID 123674276) has the molecular formula C22H22N8O and a molecular weight of 414.47 g/mol. Its IUPAC name is 15-(2-phenylimidazol-1-yl)-7-propan-2-yl-9-oxa-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene.
| Compound Name | 15-(2-phenylimidazol-1-yl)-7-propan-2-yl-9-oxa-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene |
|---|---|
| PubChem CID | 123674276 |
| Molecular Formula | C22H22N8O |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 15-(2-phenylimidazol-1-yl)-7-propan-2-yl-9-oxa-2,4,5,12,14,16-hexazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),3,5,13,15-pentaene |
| SMILES | CC(C)C12COCCN1c1nc(-n3ccnc3-c3ccccc3)ncc1-n1cnnc12 |
| InChI | InChI=1S/C22H22N8O/c1-15(2)22-13-31-11-10-30(22)19-17(29-14-25-27-20(22)29)12-24-21(26-19)28-9-8-23-18(28)16-6-4-3-5-7-16/h3-9,12,14-15H,10-11,13H2,1-2H3 |
| InChIKey | CRJLFFIEVVNBMC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |