About 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane
1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane (PubChem CID 123674308) has the molecular formula C16H32
and a molecular weight of 224.43 g/mol. Its IUPAC name is 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane.
Analyze 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane?
The IUPAC name of 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane (CID 123674308) is 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane.
What is the SMILES notation for 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane?
The canonical SMILES for 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane is CCC(C(C)C1CC1C)C(CC)(CC)CC.
What is the InChIKey of 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane?
The InChIKey is CNECBNNQKOTGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32/c1-7-15(13(6)14-11-12(14)5)16(8-2,9-3)10-4/h12-15H,7-11H2,1-6H3.
What are the key properties of 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane?
1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane has a molecular weight of 224.43 g/mol, XLogP of 5.52, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-(3,4,4-triethylhexan-2-yl)cyclopropane is sourced from PubChem (CID 123674308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).