C26H44N4O — CID 123674323
2-[[[(4E)-5-[(2,6-dimethylpiperidin-4-yl)-ethylamino]-4-methyl-3-methylidenehepta-4,6-dien-2-ylidene]amino]methyl]-N-ethyl-3-methylbut-2-enamide (PubChem CID 123674323) has the molecular formula C26H44N4O and a molecular weight of 428.67 g/mol. Its IUPAC name is 2-[[[(4E)-5-[(2,6-dimethylpiperidin-4-yl)-ethylamino]-4-methyl-3-methylidenehepta-4,6-dien-2-ylidene]amino]methyl]-N-ethyl-3-methylbut-2-enamide.
| Compound Name | 2-[[[(4E)-5-[(2,6-dimethylpiperidin-4-yl)-ethylamino]-4-methyl-3-methylidenehepta-4,6-dien-2-ylidene]amino]methyl]-N-ethyl-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 123674323 |
| Molecular Formula | C26H44N4O |
| Molecular Weight | 428.67 g/mol |
| Exact Mass | 428.35 |
| IUPAC Name | 2-[[[(4E)-5-[(2,6-dimethylpiperidin-4-yl)-ethylamino]-4-methyl-3-methylidenehepta-4,6-dien-2-ylidene]amino]methyl]-N-ethyl-3-methylbut-2-enamide |
| SMILES | C=C/C(=C(/C)C(=C)/C(C)=N/CC(C(=O)NCC)=C(C)C)N(CC)C1CC(C)NC(C)C1 |
| InChI | InChI=1S/C26H44N4O/c1-11-25(30(13-3)23-14-18(6)29-19(7)15-23)21(9)20(8)22(10)28-16-24(17(4)5)26(31)27-12-2/h11,18-19,23,29H,1,8,12-16H2,2-7,9-10H3,(H,27,31)/b25-21+,28-22+ |
| InChIKey | NZJGPYLXWDVASV-SPNOXEBBSA-N |
| XLogP | 4.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|