About 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide
4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide (PubChem CID 123674708) has the molecular formula C11H15N3O5
and a molecular weight of 269.26 g/mol. Its IUPAC name is 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide |
| PubChem CID | 123674708 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide |
| SMILES | NC(=O)c1nccn(C2CC(CO)C(O)C2O)c1=O |
| InChI | InChI=1S/C11H15N3O5/c12-10(18)7-11(19)14(2-1-13-7)6-3-5(4-15)8(16)9(6)17/h1-2,5-6,8-9,15-17H,3-4H2,(H2,12,18) |
| InChIKey | GWIJLGWDSIFGSU-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide?
The IUPAC name of 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide (CID 123674708) is 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide.
What is the SMILES notation for 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide?
The canonical SMILES for 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide is NC(=O)c1nccn(C2CC(CO)C(O)C2O)c1=O.
What is the InChIKey of 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide?
The InChIKey is GWIJLGWDSIFGSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O5/c12-10(18)7-11(19)14(2-1-13-7)6-3-5(4-15)8(16)9(6)17/h1-2,5-6,8-9,15-17H,3-4H2,(H2,12,18).
What are the key properties of 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide?
4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide has a molecular weight of 269.26 g/mol, XLogP of -2.38, 3 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,3-dihydroxy-4-(hydroxymethyl)cyclopentyl]-3-oxopyrazine-2-carboxamide is sourced from PubChem (CID 123674708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).