C24H26Cl2N2O — CID 123675177
7,7-bis(4-chlorophenyl)-5-pyrrolidin-1-yl-3-azabicyclo[3.2.2]nonan-2-one (PubChem CID 123675177) has the molecular formula C24H26Cl2N2O and a molecular weight of 429.39 g/mol. Its IUPAC name is 7,7-bis(4-chlorophenyl)-5-pyrrolidin-1-yl-3-azabicyclo[3.2.2]nonan-2-one.
| Compound Name | 7,7-bis(4-chlorophenyl)-5-pyrrolidin-1-yl-3-azabicyclo[3.2.2]nonan-2-one |
|---|---|
| PubChem CID | 123675177 |
| Molecular Formula | C24H26Cl2N2O |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 7,7-bis(4-chlorophenyl)-5-pyrrolidin-1-yl-3-azabicyclo[3.2.2]nonan-2-one |
| SMILES | O=C1NCC2(N3CCCC3)CCC1C(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C24H26Cl2N2O/c25-19-7-3-17(4-8-19)24(18-5-9-20(26)10-6-18)15-23(28-13-1-2-14-28)12-11-21(24)22(29)27-16-23/h3-10,21H,1-2,11-16H2,(H,27,29) |
| InChIKey | ZJWSDCFIURJWEO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |