C16H14Cl2N4O4 — CID 123676211
4-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]piperazine-1,2-dicarboxylic acid (PubChem CID 123676211) has the molecular formula C16H14Cl2N4O4 and a molecular weight of 397.22 g/mol. Its IUPAC name is 4-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]piperazine-1,2-dicarboxylic acid.
| Compound Name | 4-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]piperazine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 123676211 |
| Molecular Formula | C16H14Cl2N4O4 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 4-[6-(3,4-dichlorophenyl)pyrimidin-4-yl]piperazine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CN(c2cc(-c3ccc(Cl)c(Cl)c3)ncn2)CCN1C(=O)O |
| InChI | InChI=1S/C16H14Cl2N4O4/c17-10-2-1-9(5-11(10)18)12-6-14(20-8-19-12)21-3-4-22(16(25)26)13(7-21)15(23)24/h1-2,5-6,8,13H,3-4,7H2,(H,23,24)(H,25,26) |
| InChIKey | PYRMOVWRLVIDAH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |