C23H22N3+ — CID 123676680
3,21-dimethyl-9-propan-2-yl-6,21-diaza-1-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,15,17,19-decaene (PubChem CID 123676680) has the molecular formula C23H22N3+ and a molecular weight of 340.45 g/mol. Its IUPAC name is 3,21-dimethyl-9-propan-2-yl-6,21-diaza-1-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,15,17,19-decaene.
| Compound Name | 3,21-dimethyl-9-propan-2-yl-6,21-diaza-1-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,15,17,19-decaene |
|---|---|
| PubChem CID | 123676680 |
| Molecular Formula | C23H22N3+ |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3,21-dimethyl-9-propan-2-yl-6,21-diaza-1-azoniapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2,4,6,8(13),9,11,15,17,19-decaene |
| SMILES | Cc1ccnc2c3c(C(C)C)cccc3c3c4ccccc4n(C)[n+]3c12 |
| InChI | InChI=1S/C23H22N3/c1-14(2)16-9-7-10-18-20(16)21-22(15(3)12-13-24-21)26-23(18)17-8-5-6-11-19(17)25(26)4/h5-14H,1-4H3/q+1 |
| InChIKey | WYEOXBYYEODQHW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 21.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|