About [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol
[4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol (PubChem CID 123676797) has the molecular formula C16H9Cl2F3N2O
and a molecular weight of 373.16 g/mol. Its IUPAC name is [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol.
Molecular Properties
| Compound Name | [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol |
| PubChem CID | 123676797 |
| Molecular Formula | C16H9Cl2F3N2O |
| Molecular Weight | 373.16 g/mol |
| Exact Mass | 372.00 |
| IUPAC Name | [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol |
| SMILES | OC(c1ccc(F)cc1Cl)c1[nH]c(-c2c(F)cccc2F)nc1Cl |
| InChI | InChI=1S/C16H9Cl2F3N2O/c17-9-6-7(19)4-5-8(9)14(24)13-15(18)23-16(22-13)12-10(20)2-1-3-11(12)21/h1-6,14,24H,(H,22,23) |
| InChIKey | ZEVXVRCBUHCVHS-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.16 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol?
The IUPAC name of [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol (CID 123676797) is [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol.
What is the SMILES notation for [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol?
The canonical SMILES for [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol is OC(c1ccc(F)cc1Cl)c1[nH]c(-c2c(F)cccc2F)nc1Cl.
What is the InChIKey of [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol?
The InChIKey is ZEVXVRCBUHCVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9Cl2F3N2O/c17-9-6-7(19)4-5-8(9)14(24)13-15(18)23-16(22-13)12-10(20)2-1-3-11(12)21/h1-6,14,24H,(H,22,23).
What are the key properties of [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol?
[4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol has a molecular weight of 373.16 g/mol, XLogP of 4.88, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-2-(2,6-difluorophenyl)-1H-imidazol-5-yl]-(2-chloro-4-fluorophenyl)methanol is sourced from PubChem (CID 123676797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).