About ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate
ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate (PubChem CID 123677076) has the molecular formula C13H14O5S
and a molecular weight of 282.32 g/mol. Its IUPAC name is ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate.
Molecular Properties
| Compound Name | ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate |
| PubChem CID | 123677076 |
| Molecular Formula | C13H14O5S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate |
| SMILES | C=S(=O)(C=O)c1ccc(C(=O)CC(=O)OCC)cc1 |
| InChI | InChI=1S/C13H14O5S/c1-3-18-13(16)8-12(15)10-4-6-11(7-5-10)19(2,17)9-14/h4-7,9H,2-3,8H2,1H3 |
| InChIKey | OAQHWEPJBPUYJG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate?
The IUPAC name of ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate (CID 123677076) is ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate.
What is the SMILES notation for ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate?
The canonical SMILES for ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate is C=S(=O)(C=O)c1ccc(C(=O)CC(=O)OCC)cc1.
What is the InChIKey of ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate?
The InChIKey is OAQHWEPJBPUYJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O5S/c1-3-18-13(16)8-12(15)10-4-6-11(7-5-10)19(2,17)9-14/h4-7,9H,2-3,8H2,1H3.
What are the key properties of ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate?
ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate has a molecular weight of 282.32 g/mol, XLogP of 1.09, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[4-(formyl-methylidene-oxo-λ6-sulfanyl)phenyl]-3-oxopropanoate is sourced from PubChem (CID 123677076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).