C24H25ClN4O2 — CID 123677554
6-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]hexan-2-one (PubChem CID 123677554) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is 6-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]hexan-2-one.
| Compound Name | 6-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]hexan-2-one |
|---|---|
| PubChem CID | 123677554 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 6-[6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]hexan-2-one |
| SMILES | COc1ccc2c(c1)C(c1ccc(Cl)cc1)=NC(CCCCC(C)=O)c1nnc(C)n1-2 |
| InChI | InChI=1S/C24H25ClN4O2/c1-15(30)6-4-5-7-21-24-28-27-16(2)29(24)22-13-12-19(31-3)14-20(22)23(26-21)17-8-10-18(25)11-9-17/h8-14,21H,4-7H2,1-3H3 |
| InChIKey | QICNZURQVTZADI-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|