About 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial
2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial (PubChem CID 123677663) has the molecular formula C9H8F5NS
and a molecular weight of 257.23 g/mol. Its IUPAC name is 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial.
Molecular Properties
| Compound Name | 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial |
| PubChem CID | 123677663 |
| Molecular Formula | C9H8F5NS |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial |
| SMILES | [H]/N=C(\C=S)C1CCC(C(F)(F)F)=C(F)C1F |
| InChI | InChI=1S/C9H8F5NS/c10-7-4(6(15)3-16)1-2-5(8(7)11)9(12,13)14/h3-4,7,15H,1-2H2/b15-6+ |
| InChIKey | CEGIVKCXCHLMKV-GIDUJCDVSA-N |
| XLogP | 3.54 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial?
The IUPAC name of 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial (CID 123677663) is 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial.
What is the SMILES notation for 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial?
The canonical SMILES for 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial is [H]/N=C(\C=S)C1CCC(C(F)(F)F)=C(F)C1F.
What is the InChIKey of 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial?
The InChIKey is CEGIVKCXCHLMKV-GIDUJCDVSA-N. The full InChI is InChI=1S/C9H8F5NS/c10-7-4(6(15)3-16)1-2-5(8(7)11)9(12,13)14/h3-4,7,15H,1-2H2/b15-6+.
What are the key properties of 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial?
2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial has a molecular weight of 257.23 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-difluoro-4-(trifluoromethyl)cyclohex-3-en-1-yl]-2-iminoethanethial is sourced from PubChem (CID 123677663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).