C33H33N9O3 — CID 123677688
[2-[7-amino-6-cyclopropyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-5-azatricyclo[4.2.0.01,4]octan-5-yl]-[3-(2-methoxyethoxy)-1H-1,2,4-triazol-5-yl]methanone (PubChem CID 123677688) has the molecular formula C33H33N9O3 and a molecular weight of 603.69 g/mol. Its IUPAC name is [2-[7-amino-6-cyclopropyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-5-azatricyclo[4.2.0.01,4]octan-5-yl]-[3-(2-methoxyethoxy)-1H-1,2,4-triazol-5-yl]methanone.
| Compound Name | [2-[7-amino-6-cyclopropyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-5-azatricyclo[4.2.0.01,4]octan-5-yl]-[3-(2-methoxyethoxy)-1H-1,2,4-triazol-5-yl]methanone |
|---|---|
| PubChem CID | 123677688 |
| Molecular Formula | C33H33N9O3 |
| Molecular Weight | 603.69 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | [2-[7-amino-6-cyclopropyl-3-(6-phenyl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]-5-azatricyclo[4.2.0.01,4]octan-5-yl]-[3-(2-methoxyethoxy)-1H-1,2,4-triazol-5-yl]methanone |
| SMILES | COCCOc1n[nH]c(C(=O)N2C3CCC34C(c3nc5c(-c6ccc(-c7ccccc7)nc6)cnn5c(N)c3C3CC3)CC24)n1 |
| InChI | InChI=1S/C33H33N9O3/c1-44-13-14-45-32-38-29(39-40-32)31(43)41-24-11-12-33(24)22(15-25(33)41)27-26(19-7-8-19)28(34)42-30(37-27)21(17-36-42)20-9-10-23(35-16-20)18-5-3-2-4-6-18/h2-6,9-10,16-17,19,22,24-25H,7-8,11-15,34H2,1H3,(H,38,39,40) |
| InChIKey | RSDVNTRWZHUVCY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 149.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.69 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|