C19H18N8O3 — CID 123677698
3-diazenyl-2-imino-N-(oxetan-3-yl)-N'-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)butanediamide (PubChem CID 123677698) has the molecular formula C19H18N8O3 and a molecular weight of 406.41 g/mol. Its IUPAC name is 3-diazenyl-2-imino-N-(oxetan-3-yl)-N'-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)butanediamide.
| Compound Name | 3-diazenyl-2-imino-N-(oxetan-3-yl)-N'-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)butanediamide |
|---|---|
| PubChem CID | 123677698 |
| Molecular Formula | C19H18N8O3 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 3-diazenyl-2-imino-N-(oxetan-3-yl)-N'-(2-phenylimidazo[1,2-a]pyrimidin-7-yl)butanediamide |
| SMILES | [H]/N=C(\C(=O)NC1COC1)C(/N=N/[H])C(=O)Nc1ccn2cc(-c3ccccc3)nc2n1 |
| InChI | InChI=1S/C19H18N8O3/c20-15(17(28)22-12-9-30-10-12)16(26-21)18(29)24-14-6-7-27-8-13(23-19(27)25-14)11-4-2-1-3-5-11/h1-8,12,16,20-21H,9-10H2,(H,22,28)(H,23,24,25,29)/b20-15-,26-21+ |
| InChIKey | PCDYHXOYXBRWOE-IDQIGBLASA-N |
| XLogP | 1.27 |
| TPSA | 157.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|