C21H21F2N3O3S — CID 123677770
2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]-N-pyrazin-2-ylprop-2-enamide (PubChem CID 123677770) has the molecular formula C21H21F2N3O3S and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]-N-pyrazin-2-ylprop-2-enamide.
| Compound Name | 2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]-N-pyrazin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 123677770 |
| Molecular Formula | C21H21F2N3O3S |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-(4-cyclopropylsulfonylphenyl)-3-[(3R,4S)-3,4-difluorocyclopentyl]-N-pyrazin-2-ylprop-2-enamide |
| SMILES | O=C(Nc1cnccn1)C(=CC1C[C@@H](F)[C@@H](F)C1)c1ccc(S(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C21H21F2N3O3S/c22-18-10-13(11-19(18)23)9-17(21(27)26-20-12-24-7-8-25-20)14-1-3-15(4-2-14)30(28,29)16-5-6-16/h1-4,7-9,12-13,16,18-19H,5-6,10-11H2,(H,25,26,27)/t13?,18-,19+ |
| InChIKey | GPUWRXZWIVSZJV-IOZLHOSZSA-N |
| XLogP | 3.52 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|