C28H31N5O2 — CID 123677884
N-[[1-[[1-(4,6-dimethyl-2-pyridinyl)ethylideneamino]oxymethyl]cyclopropyl]methoxy]-2-phenyl-6,7-dihydro-5H-quinazolin-8-imine (PubChem CID 123677884) has the molecular formula C28H31N5O2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[[1-[[1-(4,6-dimethyl-2-pyridinyl)ethylideneamino]oxymethyl]cyclopropyl]methoxy]-2-phenyl-6,7-dihydro-5H-quinazolin-8-imine.
| Compound Name | N-[[1-[[1-(4,6-dimethyl-2-pyridinyl)ethylideneamino]oxymethyl]cyclopropyl]methoxy]-2-phenyl-6,7-dihydro-5H-quinazolin-8-imine |
|---|---|
| PubChem CID | 123677884 |
| Molecular Formula | C28H31N5O2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.25 |
| IUPAC Name | N-[[1-[[1-(4,6-dimethyl-2-pyridinyl)ethylideneamino]oxymethyl]cyclopropyl]methoxy]-2-phenyl-6,7-dihydro-5H-quinazolin-8-imine |
| SMILES | CC(=NOCC1(CON=C2CCCc3cnc(-c4ccccc4)nc32)CC1)c1cc(C)cc(C)n1 |
| InChI | InChI=1S/C28H31N5O2/c1-19-14-20(2)30-25(15-19)21(3)32-34-17-28(12-13-28)18-35-33-24-11-7-10-23-16-29-27(31-26(23)24)22-8-5-4-6-9-22/h4-6,8-9,14-16H,7,10-13,17-18H2,1-3H3 |
| InChIKey | AZDNNMYWCHPYOD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 81.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|