C25H20N2O7S — CID 123678171
[2-(3,4-dihydroxyphenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4,5-dihydroxypyrrol-3-yl]-(5-methylfuran-2-yl)methanone (PubChem CID 123678171) has the molecular formula C25H20N2O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4,5-dihydroxypyrrol-3-yl]-(5-methylfuran-2-yl)methanone.
| Compound Name | [2-(3,4-dihydroxyphenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4,5-dihydroxypyrrol-3-yl]-(5-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 123678171 |
| Molecular Formula | C25H20N2O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-4,5-dihydroxypyrrol-3-yl]-(5-methylfuran-2-yl)methanone |
| SMILES | CCOc1ccc2nc(-n3c(O)c(O)c(C(=O)c4ccc(C)o4)c3-c3ccc(O)c(O)c3)sc2c1 |
| InChI | InChI=1S/C25H20N2O7S/c1-3-33-14-6-7-15-19(11-14)35-25(26-15)27-21(13-5-8-16(28)17(29)10-13)20(23(31)24(27)32)22(30)18-9-4-12(2)34-18/h4-11,28-29,31-32H,3H2,1-2H3 |
| InChIKey | KGUWROVXLYDMFE-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 138.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|