C25H40O4 — CID 123678931
2-(3-ethyl-6,9-dimethyldodec-5-en-3-yl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione (PubChem CID 123678931) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is 2-(3-ethyl-6,9-dimethyldodec-5-en-3-yl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(3-ethyl-6,9-dimethyldodec-5-en-3-yl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 123678931 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | 2-(3-ethyl-6,9-dimethyldodec-5-en-3-yl)-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CCCC(C)CCC(C)=CCC(CC)(CC)C1=C(C)C(=O)C(OC)=C(OC)C1=O |
| InChI | InChI=1S/C25H40O4/c1-9-12-17(4)13-14-18(5)15-16-25(10-2,11-3)20-19(6)21(26)23(28-7)24(29-8)22(20)27/h15,17H,9-14,16H2,1-8H3 |
| InChIKey | JGZAMYBYFKBHIX-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|