C17H15N3O3S — CID 123679604
8-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3,4-dihydro-2H-5,1,2-benzoxathiazepine (PubChem CID 123679604) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is 8-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3,4-dihydro-2H-5,1,2-benzoxathiazepine.
| Compound Name | 8-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3,4-dihydro-2H-5,1,2-benzoxathiazepine |
|---|---|
| PubChem CID | 123679604 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 8-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenoxy]-3,4-dihydro-2H-5,1,2-benzoxathiazepine |
| SMILES | Cc1nc(-c2ccc(Oc3ccc4c(c3)SNCCO4)cc2)no1 |
| InChI | InChI=1S/C17H15N3O3S/c1-11-19-17(20-23-11)12-2-4-13(5-3-12)22-14-6-7-15-16(10-14)24-18-8-9-21-15/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | IDUUOZAOCULWRV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|