About 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane
8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane (PubChem CID 123680050) has the molecular formula C17H12BBr3N4O2
and a molecular weight of 554.83 g/mol. Its IUPAC name is 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane.
Molecular Properties
| Compound Name | 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane |
| PubChem CID | 123680050 |
| Molecular Formula | C17H12BBr3N4O2 |
| Molecular Weight | 554.83 g/mol |
| Exact Mass | 551.86 |
| IUPAC Name | 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane |
| SMILES | BrB(Br)Br.Cc1ccc2c(c1)nc1nc(-c3ccc([N+](=O)[O-])cc3)ccn12 |
| InChI | InChI=1S/C17H12N4O2.BBr3/c1-11-2-7-16-15(10-11)19-17-18-14(8-9-20(16)17)12-3-5-13(6-4-12)21(22)23;2-1(3)4/h2-10H,1H3; |
| InChIKey | HCAPZRCRVVDJEO-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.83 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane?
The IUPAC name of 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane (CID 123680050) is 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane.
What is the SMILES notation for 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane?
The canonical SMILES for 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane is BrB(Br)Br.Cc1ccc2c(c1)nc1nc(-c3ccc([N+](=O)[O-])cc3)ccn12.
What is the InChIKey of 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane?
The InChIKey is HCAPZRCRVVDJEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O2.BBr3/c1-11-2-7-16-15(10-11)19-17-18-14(8-9-20(16)17)12-3-5-13(6-4-12)21(22)23;2-1(3)4/h2-10H,1H3;.
What are the key properties of 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane?
8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane has a molecular weight of 554.83 g/mol, XLogP of 5.92, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-2-(4-nitrophenyl)pyrimido[1,2-a]benzimidazole;tribromoborane is sourced from PubChem (CID 123680050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).